C18H22N6O2 — CID 172961635
(Z)-3,3-dimethyl-N-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methoxy]-1-(1,2,4-triazol-1-yl)butan-2-imine (PubChem CID 172961635) has the molecular formula C18H22N6O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is (Z)-3,3-dimethyl-N-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methoxy]-1-(1,2,4-triazol-1-yl)butan-2-imine.
| Compound Name | (Z)-3,3-dimethyl-N-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methoxy]-1-(1,2,4-triazol-1-yl)butan-2-imine |
|---|---|
| PubChem CID | 172961635 |
| Molecular Formula | C18H22N6O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | (Z)-3,3-dimethyl-N-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methoxy]-1-(1,2,4-triazol-1-yl)butan-2-imine |
| SMILES | Cc1ccc(-c2nnc(CO/N=C(\Cn3cncn3)C(C)(C)C)o2)cc1 |
| InChI | InChI=1S/C18H22N6O2/c1-13-5-7-14(8-6-13)17-22-21-16(26-17)10-25-23-15(18(2,3)4)9-24-12-19-11-20-24/h5-8,11-12H,9-10H2,1-4H3/b23-15+ |
| InChIKey | RVZIEPLFGBWSDX-HZHRSRAPSA-N |
| XLogP | 3.26 |
| TPSA | 91.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|