C12H10 — CID 172975736
2,8b-dihydro-1H-acenaphthylene (PubChem CID 172975736) has the molecular formula C12H10 and a molecular weight of 154.21 g/mol. Its IUPAC name is 2,8b-dihydro-1H-acenaphthylene.
| Compound Name | 2,8b-dihydro-1H-acenaphthylene |
|---|---|
| PubChem CID | 172975736 |
| Molecular Formula | C12H10 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | 2,8b-dihydro-1H-acenaphthylene |
| SMILES | C1=CC=C2CCC3=CC=CC=1C23 |
| InChI | InChI=1S/C12H10/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-3,5-6,12H,7-8H2 |
| InChIKey | VKSATPDKGLBGQZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |