C25H21N3O4S2 — CID 18783163
1,1-bis(4-sulfonyl-2,8b-dihydro-1H-acenaphthylen-5-yl)guanidine (PubChem CID 18783163) has the molecular formula C25H21N3O4S2 and a molecular weight of 491.59 g/mol. Its IUPAC name is 1,1-bis(4-sulfonyl-2,8b-dihydro-1H-acenaphthylen-5-yl)guanidine.
| Compound Name | 1,1-bis(4-sulfonyl-2,8b-dihydro-1H-acenaphthylen-5-yl)guanidine |
|---|---|
| PubChem CID | 18783163 |
| Molecular Formula | C25H21N3O4S2 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | 1,1-bis(4-sulfonyl-2,8b-dihydro-1H-acenaphthylen-5-yl)guanidine |
| SMILES | [H]/N=C(\N)N(C1=C2C=CC=C3CCC(=CC1=S(=O)=O)C32)C1=C2C=CC=C3CCC(=CC1=S(=O)=O)C32 |
| InChI | InChI=1S/C25H21N3O4S2/c26-25(27)28(23-17-5-1-3-13-7-9-15(21(13)17)11-19(23)33(29)30)24-18-6-2-4-14-8-10-16(22(14)18)12-20(24)34(31)32/h1-6,11-12,21-22H,7-10H2,(H3,26,27) |
| InChIKey | CGYXOCOBEQHJRZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 121.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|