About 6-fluoro-2-isocyanato-4H-1,3-benzodioxine
6-fluoro-2-isocyanato-4H-1,3-benzodioxine (PubChem CID 173027164) has the molecular formula C9H6FNO3
and a molecular weight of 195.15 g/mol. Its IUPAC name is 6-fluoro-2-isocyanato-4H-1,3-benzodioxine.
Molecular Properties
| Compound Name | 6-fluoro-2-isocyanato-4H-1,3-benzodioxine |
| PubChem CID | 173027164 |
| Molecular Formula | C9H6FNO3 |
| Molecular Weight | 195.15 g/mol |
| Exact Mass | 195.03 |
| IUPAC Name | 6-fluoro-2-isocyanato-4H-1,3-benzodioxine |
| SMILES | O=C=NC1OCc2cc(F)ccc2O1 |
| InChI | InChI=1S/C9H6FNO3/c10-7-1-2-8-6(3-7)4-13-9(14-8)11-5-12/h1-3,9H,4H2 |
| InChIKey | JIRJQSQJSDVFIU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.15 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-2-isocyanato-4H-1,3-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2-isocyanato-4H-1,3-benzodioxine?
The IUPAC name of 6-fluoro-2-isocyanato-4H-1,3-benzodioxine (CID 173027164) is 6-fluoro-2-isocyanato-4H-1,3-benzodioxine.
What is the SMILES notation for 6-fluoro-2-isocyanato-4H-1,3-benzodioxine?
The canonical SMILES for 6-fluoro-2-isocyanato-4H-1,3-benzodioxine is O=C=NC1OCc2cc(F)ccc2O1.
What is the InChIKey of 6-fluoro-2-isocyanato-4H-1,3-benzodioxine?
The InChIKey is JIRJQSQJSDVFIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6FNO3/c10-7-1-2-8-6(3-7)4-13-9(14-8)11-5-12/h1-3,9H,4H2.
What are the key properties of 6-fluoro-2-isocyanato-4H-1,3-benzodioxine?
6-fluoro-2-isocyanato-4H-1,3-benzodioxine has a molecular weight of 195.15 g/mol, XLogP of 1.35, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2-isocyanato-4H-1,3-benzodioxine is sourced from PubChem (CID 173027164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).