About indigane;3-sulfanylpropane-1,2-diol
indigane;3-sulfanylpropane-1,2-diol (PubChem CID 173044217) has the molecular formula C3H11InO2S
and a molecular weight of 226.00 g/mol. Its IUPAC name is indigane;3-sulfanylpropane-1,2-diol.
Molecular Properties
| Compound Name | indigane;3-sulfanylpropane-1,2-diol |
| PubChem CID | 173044217 |
| Molecular Formula | C3H11InO2S |
| Molecular Weight | 226.00 g/mol |
| Exact Mass | 225.95 |
| IUPAC Name | indigane;3-sulfanylpropane-1,2-diol |
| SMILES | OCC(O)CS.[InH3] |
| InChI | InChI=1S/C3H8O2S.In.3H/c4-1-3(5)2-6;;;;/h3-6H,1-2H2;;;; |
| InChIKey | WETFZLPZSJVKPF-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.00 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze indigane;3-sulfanylpropane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indigane;3-sulfanylpropane-1,2-diol?
The IUPAC name of indigane;3-sulfanylpropane-1,2-diol (CID 173044217) is indigane;3-sulfanylpropane-1,2-diol.
What is the SMILES notation for indigane;3-sulfanylpropane-1,2-diol?
The canonical SMILES for indigane;3-sulfanylpropane-1,2-diol is OCC(O)CS.[InH3].
What is the InChIKey of indigane;3-sulfanylpropane-1,2-diol?
The InChIKey is WETFZLPZSJVKPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O2S.In.3H/c4-1-3(5)2-6;;;;/h3-6H,1-2H2;;;;.
What are the key properties of indigane;3-sulfanylpropane-1,2-diol?
indigane;3-sulfanylpropane-1,2-diol has a molecular weight of 226.00 g/mol, XLogP of -1.91, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for indigane;3-sulfanylpropane-1,2-diol is sourced from PubChem (CID 173044217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).