C3H8N+ — CID 173056394
trideuterio(1,1,2,3,3-pentadeuterioprop-2-enyl)azanium (PubChem CID 173056394) has the molecular formula C3H8N+ and a molecular weight of 66.15 g/mol. Its IUPAC name is trideuterio(1,1,2,3,3-pentadeuterioprop-2-enyl)azanium.
| Compound Name | trideuterio(1,1,2,3,3-pentadeuterioprop-2-enyl)azanium |
|---|---|
| PubChem CID | 173056394 |
| Molecular Formula | C3H8N+ |
| Molecular Weight | 66.15 g/mol |
| Exact Mass | 66.12 |
| IUPAC Name | trideuterio(1,1,2,3,3-pentadeuterioprop-2-enyl)azanium |
| SMILES | [2H]C([2H])=C([2H])C([2H])([2H])[N+]([2H])([2H])[2H] |
| InChI | InChI=1S/C3H7N/c1-2-3-4/h2H,1,3-4H2/p+1/i1D2,2D,3D2/hD3 |
| InChIKey | VVJKKWFAADXIJK-BQTWOVQESA-O |
| XLogP | -0.59 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 4 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 66.15 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|