C29H33N5O6 — CID 173095942
(7E)-4-formyl-17-(6-methoxy-2-phenylpyrimidin-4-yl)oxy-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-13-carboxamide (PubChem CID 173095942) has the molecular formula C29H33N5O6 and a molecular weight of 547.61 g/mol. Its IUPAC name is (7E)-4-formyl-17-(6-methoxy-2-phenylpyrimidin-4-yl)oxy-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-13-carboxamide.
| Compound Name | (7E)-4-formyl-17-(6-methoxy-2-phenylpyrimidin-4-yl)oxy-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-13-carboxamide |
|---|---|
| PubChem CID | 173095942 |
| Molecular Formula | C29H33N5O6 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | (7E)-4-formyl-17-(6-methoxy-2-phenylpyrimidin-4-yl)oxy-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-13-carboxamide |
| SMILES | COc1cc(OC2CC3C(=O)NC4(C=O)CC4/C=C/CCCCN(C(N)=O)C(=O)C3C2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C29H33N5O6/c1-39-23-15-24(32-25(31-23)18-9-5-4-6-10-18)40-20-13-21-22(14-20)27(37)34(28(30)38)12-8-3-2-7-11-19-16-29(19,17-35)33-26(21)36/h4-7,9-11,15,17,19-22H,2-3,8,12-14,16H2,1H3,(H2,30,38)(H,33,36)/b11-7+ |
| InChIKey | VCKXBEOHDIZRAV-YRNVUSSQSA-N |
| XLogP | 2.65 |
| TPSA | 153.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|