C22H16N6 — CID 173110678
6-(5-methyl-1H-1,2,4-triazol-3-yl)-2,3-diphenylpyrido[2,3-b]pyrazine (PubChem CID 173110678) has the molecular formula C22H16N6 and a molecular weight of 364.41 g/mol. Its IUPAC name is 6-(5-methyl-1H-1,2,4-triazol-3-yl)-2,3-diphenylpyrido[2,3-b]pyrazine.
| Compound Name | 6-(5-methyl-1H-1,2,4-triazol-3-yl)-2,3-diphenylpyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 173110678 |
| Molecular Formula | C22H16N6 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 6-(5-methyl-1H-1,2,4-triazol-3-yl)-2,3-diphenylpyrido[2,3-b]pyrazine |
| SMILES | Cc1nc(-c2ccc3nc(-c4ccccc4)c(-c4ccccc4)nc3n2)n[nH]1 |
| InChI | InChI=1S/C22H16N6/c1-14-23-22(28-27-14)18-13-12-17-21(25-18)26-20(16-10-6-3-7-11-16)19(24-17)15-8-4-2-5-9-15/h2-13H,1H3,(H,23,27,28) |
| InChIKey | CMELGLCUGGDLOK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |