About [hydroxy(oxo)silyl] hypochlorite
[hydroxy(oxo)silyl] hypochlorite (PubChem CID 173148006) has the molecular formula HClO3Si
and a molecular weight of 112.54 g/mol. Its IUPAC name is [hydroxy(oxo)silyl] hypochlorite.
Molecular Properties
| Compound Name | [hydroxy(oxo)silyl] hypochlorite |
| PubChem CID | 173148006 |
| Molecular Formula | HClO3Si |
| Molecular Weight | 112.54 g/mol |
| Exact Mass | 111.94 |
| IUPAC Name | [hydroxy(oxo)silyl] hypochlorite |
| SMILES | O=[Si](O)OCl |
| InChI | InChI=1S/ClHO3Si/c1-4-5(2)3/h2H |
| InChIKey | MJMNNSDWENTAAP-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.54 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [hydroxy(oxo)silyl] hypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [hydroxy(oxo)silyl] hypochlorite?
The IUPAC name of [hydroxy(oxo)silyl] hypochlorite (CID 173148006) is [hydroxy(oxo)silyl] hypochlorite.
What is the SMILES notation for [hydroxy(oxo)silyl] hypochlorite?
The canonical SMILES for [hydroxy(oxo)silyl] hypochlorite is O=[Si](O)OCl.
What is the InChIKey of [hydroxy(oxo)silyl] hypochlorite?
The InChIKey is MJMNNSDWENTAAP-UHFFFAOYSA-N. The full InChI is InChI=1S/ClHO3Si/c1-4-5(2)3/h2H.
What are the key properties of [hydroxy(oxo)silyl] hypochlorite?
[hydroxy(oxo)silyl] hypochlorite has a molecular weight of 112.54 g/mol, XLogP of -0.44, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [hydroxy(oxo)silyl] hypochlorite is sourced from PubChem (CID 173148006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).