C17H10BrClF3NO — CID 173151644
2-[3-bromo-1-(2,4,5-trifluoro-3-methylphenyl)prop-1-en-2-yl]-5-chloro-1,3-benzoxazole (PubChem CID 173151644) has the molecular formula C17H10BrClF3NO and a molecular weight of 416.62 g/mol. Its IUPAC name is 2-[3-bromo-1-(2,4,5-trifluoro-3-methylphenyl)prop-1-en-2-yl]-5-chloro-1,3-benzoxazole.
| Compound Name | 2-[3-bromo-1-(2,4,5-trifluoro-3-methylphenyl)prop-1-en-2-yl]-5-chloro-1,3-benzoxazole |
|---|---|
| PubChem CID | 173151644 |
| Molecular Formula | C17H10BrClF3NO |
| Molecular Weight | 416.62 g/mol |
| Exact Mass | 414.96 |
| IUPAC Name | 2-[3-bromo-1-(2,4,5-trifluoro-3-methylphenyl)prop-1-en-2-yl]-5-chloro-1,3-benzoxazole |
| SMILES | Cc1c(F)c(F)cc(C=C(CBr)c2nc3cc(Cl)ccc3o2)c1F |
| InChI | InChI=1S/C17H10BrClF3NO/c1-8-15(21)9(5-12(20)16(8)22)4-10(7-18)17-23-13-6-11(19)2-3-14(13)24-17/h2-6H,7H2,1H3 |
| InChIKey | RUHBSAQZRVDQHZ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.62 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|