C18H18N3O3S+ — CID 173152534
amino-[3-[4-(1,3-dioxoisoindol-2-yl)butylsulfanyl]phenyl]-oxoazanium (PubChem CID 173152534) has the molecular formula C18H18N3O3S+ and a molecular weight of 356.43 g/mol. Its IUPAC name is amino-[3-[4-(1,3-dioxoisoindol-2-yl)butylsulfanyl]phenyl]-oxoazanium.
| Compound Name | amino-[3-[4-(1,3-dioxoisoindol-2-yl)butylsulfanyl]phenyl]-oxoazanium |
|---|---|
| PubChem CID | 173152534 |
| Molecular Formula | C18H18N3O3S+ |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | amino-[3-[4-(1,3-dioxoisoindol-2-yl)butylsulfanyl]phenyl]-oxoazanium |
| SMILES | N[N+](=O)c1cccc(SCCCCN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C18H18N3O3S/c19-21(24)13-6-5-7-14(12-13)25-11-4-3-10-20-17(22)15-8-1-2-9-16(15)18(20)23/h1-2,5-9,12H,3-4,10-11H2,(H2,19,24)/q+1 |
| InChIKey | HGSZZJHYXJEGSA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|