C50H88O8 — CID 173154242
5,9-dimethyl-2-propan-2-yldeca-4,8-dienoic acid;3-ethenyl-3,7-dimethyl-2-propan-2-yloct-6-enoic acid;2-ethyl-5,9-dimethyldeca-4,8-dienoic acid;4-methylpentanoic acid (PubChem CID 173154242) has the molecular formula C50H88O8 and a molecular weight of 817.25 g/mol. Its IUPAC name is 5,9-dimethyl-2-propan-2-yldeca-4,8-dienoic acid;3-ethenyl-3,7-dimethyl-2-propan-2-yloct-6-enoic acid;2-ethyl-5,9-dimethyldeca-4,8-dienoic acid;4-methylpentanoic acid.
| Compound Name | 5,9-dimethyl-2-propan-2-yldeca-4,8-dienoic acid;3-ethenyl-3,7-dimethyl-2-propan-2-yloct-6-enoic acid;2-ethyl-5,9-dimethyldeca-4,8-dienoic acid;4-methylpentanoic acid |
|---|---|
| PubChem CID | 173154242 |
| Molecular Formula | C50H88O8 |
| Molecular Weight | 817.25 g/mol |
| Exact Mass | 816.65 |
| IUPAC Name | 5,9-dimethyl-2-propan-2-yldeca-4,8-dienoic acid;3-ethenyl-3,7-dimethyl-2-propan-2-yloct-6-enoic acid;2-ethyl-5,9-dimethyldeca-4,8-dienoic acid;4-methylpentanoic acid |
| SMILES | C=CC(C)(CCC=C(C)C)C(C(=O)O)C(C)C.CC(C)=CCCC(C)=CCC(C(=O)O)C(C)C.CC(C)CCC(=O)O.CCC(CC=C(C)CCC=C(C)C)C(=O)O |
| InChI | InChI=1S/2C15H26O2.C14H24O2.C6H12O2/c1-11(2)7-6-8-13(5)9-10-14(12(3)4)15(16)17;1-7-15(6,10-8-9-11(2)3)13(12(4)5)14(16)17;1-5-13(14(15)16)10-9-12(4)8-6-7-11(2)3;1-5(2)3-4-6(7)8/h7,9,12,14H,6,8,10H2,1-5H3,(H,16,17);7,9,12-13H,1,8,10H2,2-6H3,(H,16,17);7,9,13H,5-6,8,10H2,1-4H3,(H,15,16);5H,3-4H2,1-2H3,(H,7,8) |
| InChIKey | SHNVPHQBYPPKNK-UHFFFAOYSA-N |
| XLogP | 14.40 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.25 |
| LogP ≤ 5 | 14.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|