C27H48O7 — CID 173207504
[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxotetracos-15-enyl] prop-2-enoate (PubChem CID 173207504) has the molecular formula C27H48O7 and a molecular weight of 484.67 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxotetracos-15-enyl] prop-2-enoate.
| Compound Name | [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxotetracos-15-enyl] prop-2-enoate |
|---|---|
| PubChem CID | 173207504 |
| Molecular Formula | C27H48O7 |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.34 |
| IUPAC Name | [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxotetracos-15-enyl] prop-2-enoate |
| SMILES | C=CC(=O)OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)CCCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C27H48O7/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(28)25(31)27(33)26(32)23(29)21-34-24(30)4-2/h4,11-12,23,25-27,29,31-33H,2-3,5-10,13-21H2,1H3/t23-,25+,26-,27-/m1/s1 |
| InChIKey | QRYFSEHYCIGNOC-INVSNAKLSA-N |
| XLogP | 4.16 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|