C16H17NO5 — CID 173211065
2-[[5-(1,3-benzodioxol-5-yl)-2-methylpenta-2,4-dienoyl]amino]propanoic acid (PubChem CID 173211065) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is 2-[[5-(1,3-benzodioxol-5-yl)-2-methylpenta-2,4-dienoyl]amino]propanoic acid.
| Compound Name | 2-[[5-(1,3-benzodioxol-5-yl)-2-methylpenta-2,4-dienoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 173211065 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-[[5-(1,3-benzodioxol-5-yl)-2-methylpenta-2,4-dienoyl]amino]propanoic acid |
| SMILES | CC(=CC=Cc1ccc2c(c1)OCO2)C(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C16H17NO5/c1-10(15(18)17-11(2)16(19)20)4-3-5-12-6-7-13-14(8-12)22-9-21-13/h3-8,11H,9H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | HEUSTISQCPYAAU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|