C5H4OSi — CID 173213237
6-silabicyclo[3.1.0]hexa-1,4-dien-3-one (PubChem CID 173213237) has the molecular formula C5H4OSi and a molecular weight of 108.17 g/mol. Its IUPAC name is 6-silabicyclo[3.1.0]hexa-1,4-dien-3-one.
| Compound Name | 6-silabicyclo[3.1.0]hexa-1,4-dien-3-one |
|---|---|
| PubChem CID | 173213237 |
| Molecular Formula | C5H4OSi |
| Molecular Weight | 108.17 g/mol |
| Exact Mass | 108.00 |
| IUPAC Name | 6-silabicyclo[3.1.0]hexa-1,4-dien-3-one |
| SMILES | O=C1C=C2[SiH2]C2=C1 |
| InChI | InChI=1S/C5H4OSi/c6-3-1-4-5(2-3)7-4/h1-2H,7H2 |
| InChIKey | FCFZWDCDJGTRMA-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 108.17 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|