C23H23ClNNaO7S — CID 173221315
sodium;5-[4-[2-[[(1S)-1-(3-chlorophenyl)-1-hydroxyethyl]amino]ethoxy]phenyl]sulfonyl-2-hydroxybenzoic acid;hydride (PubChem CID 173221315) has the molecular formula C23H23ClNNaO7S and a molecular weight of 515.95 g/mol. Its IUPAC name is sodium;5-[4-[2-[[(1S)-1-(3-chlorophenyl)-1-hydroxyethyl]amino]ethoxy]phenyl]sulfonyl-2-hydroxybenzoic acid;hydride.
| Compound Name | sodium;5-[4-[2-[[(1S)-1-(3-chlorophenyl)-1-hydroxyethyl]amino]ethoxy]phenyl]sulfonyl-2-hydroxybenzoic acid;hydride |
|---|---|
| PubChem CID | 173221315 |
| Molecular Formula | C23H23ClNNaO7S |
| Molecular Weight | 515.95 g/mol |
| Exact Mass | 515.08 |
| IUPAC Name | sodium;5-[4-[2-[[(1S)-1-(3-chlorophenyl)-1-hydroxyethyl]amino]ethoxy]phenyl]sulfonyl-2-hydroxybenzoic acid;hydride |
| SMILES | C[C@@](O)(NCCOc1ccc(S(=O)(=O)c2ccc(O)c(C(=O)O)c2)cc1)c1cccc(Cl)c1.[H-].[Na+] |
| InChI | InChI=1S/C23H22ClNO7S.Na.H/c1-23(29,15-3-2-4-16(24)13-15)25-11-12-32-17-5-7-18(8-6-17)33(30,31)19-9-10-21(26)20(14-19)22(27)28;;/h2-10,13-14,25-26,29H,11-12H2,1H3,(H,27,28);;/q;+1;-1/t23-;;/m0../s1 |
| InChIKey | RIRYLVFCUJIACU-IFUPQEAVSA-N |
| XLogP | 0.53 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.95 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|