About 1-phenylethanethiol;hydrobromide
1-phenylethanethiol;hydrobromide (PubChem CID 173223511) has the molecular formula C8H11BrS
and a molecular weight of 219.15 g/mol. Its IUPAC name is 1-phenylethanethiol;hydrobromide.
Molecular Properties
| Compound Name | 1-phenylethanethiol;hydrobromide |
| PubChem CID | 173223511 |
| Molecular Formula | C8H11BrS |
| Molecular Weight | 219.15 g/mol |
| Exact Mass | 217.98 |
| IUPAC Name | 1-phenylethanethiol;hydrobromide |
| SMILES | Br.CC(S)c1ccccc1 |
| InChI | InChI=1S/C8H10S.BrH/c1-7(9)8-5-3-2-4-6-8;/h2-7,9H,1H3;1H |
| InChIKey | SFIQTSSUVIQTGK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.15 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylethanethiol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethanethiol;hydrobromide?
The IUPAC name of 1-phenylethanethiol;hydrobromide (CID 173223511) is 1-phenylethanethiol;hydrobromide.
What is the SMILES notation for 1-phenylethanethiol;hydrobromide?
The canonical SMILES for 1-phenylethanethiol;hydrobromide is Br.CC(S)c1ccccc1.
What is the InChIKey of 1-phenylethanethiol;hydrobromide?
The InChIKey is SFIQTSSUVIQTGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10S.BrH/c1-7(9)8-5-3-2-4-6-8;/h2-7,9H,1H3;1H.
What are the key properties of 1-phenylethanethiol;hydrobromide?
1-phenylethanethiol;hydrobromide has a molecular weight of 219.15 g/mol, XLogP of 3.26, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethanethiol;hydrobromide is sourced from PubChem (CID 173223511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).