About bismuthane;dodecanedioic acid
bismuthane;dodecanedioic acid (PubChem CID 173224414) has the molecular formula C12H25BiO4
and a molecular weight of 442.31 g/mol. Its IUPAC name is bismuthane;dodecanedioic acid.
Molecular Properties
| Compound Name | bismuthane;dodecanedioic acid |
| PubChem CID | 173224414 |
| Molecular Formula | C12H25BiO4 |
| Molecular Weight | 442.31 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | bismuthane;dodecanedioic acid |
| SMILES | O=C(O)CCCCCCCCCCC(=O)O.[BiH3] |
| InChI | InChI=1S/C12H22O4.Bi.3H/c13-11(14)9-7-5-3-1-2-4-6-8-10-12(15)16;;;;/h1-10H2,(H,13,14)(H,15,16);;;; |
| InChIKey | MOCDSAGCBCNTSG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bismuthane;dodecanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bismuthane;dodecanedioic acid?
The IUPAC name of bismuthane;dodecanedioic acid (CID 173224414) is bismuthane;dodecanedioic acid.
What is the SMILES notation for bismuthane;dodecanedioic acid?
The canonical SMILES for bismuthane;dodecanedioic acid is O=C(O)CCCCCCCCCCC(=O)O.[BiH3].
What is the InChIKey of bismuthane;dodecanedioic acid?
The InChIKey is MOCDSAGCBCNTSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O4.Bi.3H/c13-11(14)9-7-5-3-1-2-4-6-8-10-12(15)16;;;;/h1-10H2,(H,13,14)(H,15,16);;;;.
What are the key properties of bismuthane;dodecanedioic acid?
bismuthane;dodecanedioic acid has a molecular weight of 442.31 g/mol, XLogP of 1.87, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bismuthane;dodecanedioic acid is sourced from PubChem (CID 173224414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).