C52H63O2Si3 — CID 173246388
CID 173246388 (PubChem CID 173246388) has the molecular formula C52H63O2Si3 and a molecular weight of 804.33 g/mol.
| Compound Name | CID 173246388 |
|---|---|
| PubChem CID | 173246388 |
| Molecular Formula | C52H63O2Si3 |
| Molecular Weight | 804.33 g/mol |
| Exact Mass | 803.41 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si](OC1=CC2=C(CCCC2)C1C[SiH]CC1C(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)=CC2=C1CCCC2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C52H63O2Si3/c1-51(2,3)56(41-25-11-7-12-26-41,42-27-13-8-14-28-42)53-49-35-39-23-19-21-33-45(39)47(49)37-55-38-48-46-34-22-20-24-40(46)36-50(48)54-57(52(4,5)6,43-29-15-9-16-30-43)44-31-17-10-18-32-44/h7-18,25-32,35-36,47-48,55H,19-24,33-34,37-38H2,1-6H3 |
| InChIKey | CDDRHLLHOGOZOK-UHFFFAOYSA-N |
| XLogP | 11.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.33 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|