C13H13Zr- — CID 173268432
2,4a,9,9a-tetrahydro-1H-fluoren-9-ide;zirconium (PubChem CID 173268432) has the molecular formula C13H13Zr- and a molecular weight of 260.47 g/mol. Its IUPAC name is 2,4a,9,9a-tetrahydro-1H-fluoren-9-ide;zirconium.
| Compound Name | 2,4a,9,9a-tetrahydro-1H-fluoren-9-ide;zirconium |
|---|---|
| PubChem CID | 173268432 |
| Molecular Formula | C13H13Zr- |
| Molecular Weight | 260.47 g/mol |
| Exact Mass | 259.01 |
| IUPAC Name | 2,4a,9,9a-tetrahydro-1H-fluoren-9-ide;zirconium |
| SMILES | C1=CC2c3ccccc3[CH-]C2CC1.[Zr] |
| InChI | InChI=1S/C13H13.Zr/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;/h1,3-5,7-9,11,13H,2,6H2;/q-1; |
| InChIKey | LWUGNYPSCYQHGW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|