C22H29Cl2N3O2 — CID 173299060
5-(5,6-dichloro-1H-indol-2-yl)-N-[1-(dimethylamino)-2,2-dimethylpropyl]-2-methoxy-N-methylpenta-2,4-dienamide (PubChem CID 173299060) has the molecular formula C22H29Cl2N3O2 and a molecular weight of 438.40 g/mol. Its IUPAC name is 5-(5,6-dichloro-1H-indol-2-yl)-N-[1-(dimethylamino)-2,2-dimethylpropyl]-2-methoxy-N-methylpenta-2,4-dienamide.
| Compound Name | 5-(5,6-dichloro-1H-indol-2-yl)-N-[1-(dimethylamino)-2,2-dimethylpropyl]-2-methoxy-N-methylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 173299060 |
| Molecular Formula | C22H29Cl2N3O2 |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 5-(5,6-dichloro-1H-indol-2-yl)-N-[1-(dimethylamino)-2,2-dimethylpropyl]-2-methoxy-N-methylpenta-2,4-dienamide |
| SMILES | COC(=CC=Cc1cc2cc(Cl)c(Cl)cc2[nH]1)C(=O)N(C)C(N(C)C)C(C)(C)C |
| InChI | InChI=1S/C22H29Cl2N3O2/c1-22(2,3)21(26(4)5)27(6)20(28)19(29-7)10-8-9-15-11-14-12-16(23)17(24)13-18(14)25-15/h8-13,21,25H,1-7H3 |
| InChIKey | KDRYXDFBRVDIJI-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|