About S-(ethylamino) N-hexylcarbamothioate
S-(ethylamino) N-hexylcarbamothioate (PubChem CID 173301589) has the molecular formula C9H20N2OS
and a molecular weight of 204.34 g/mol. Its IUPAC name is S-(ethylamino) N-hexylcarbamothioate.
Molecular Properties
| Compound Name | S-(ethylamino) N-hexylcarbamothioate |
| PubChem CID | 173301589 |
| Molecular Formula | C9H20N2OS |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | S-(ethylamino) N-hexylcarbamothioate |
| SMILES | CCCCCCNC(=O)SNCC |
| InChI | InChI=1S/C9H20N2OS/c1-3-5-6-7-8-10-9(12)13-11-4-2/h11H,3-8H2,1-2H3,(H,10,12) |
| InChIKey | YQCGHDLNQZUCBZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(ethylamino) N-hexylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(ethylamino) N-hexylcarbamothioate?
The IUPAC name of S-(ethylamino) N-hexylcarbamothioate (CID 173301589) is S-(ethylamino) N-hexylcarbamothioate.
What is the SMILES notation for S-(ethylamino) N-hexylcarbamothioate?
The canonical SMILES for S-(ethylamino) N-hexylcarbamothioate is CCCCCCNC(=O)SNCC.
What is the InChIKey of S-(ethylamino) N-hexylcarbamothioate?
The InChIKey is YQCGHDLNQZUCBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2OS/c1-3-5-6-7-8-10-9(12)13-11-4-2/h11H,3-8H2,1-2H3,(H,10,12).
What are the key properties of S-(ethylamino) N-hexylcarbamothioate?
S-(ethylamino) N-hexylcarbamothioate has a molecular weight of 204.34 g/mol, XLogP of 2.53, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(ethylamino) N-hexylcarbamothioate is sourced from PubChem (CID 173301589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).