C14H16CaO5 — CID 173320715
calcium;but-2-enedioate;3-penta-1,4-dien-3-yloxypenta-1,4-diene (PubChem CID 173320715) has the molecular formula C14H16CaO5 and a molecular weight of 304.36 g/mol. Its IUPAC name is calcium;but-2-enedioate;3-penta-1,4-dien-3-yloxypenta-1,4-diene.
| Compound Name | calcium;but-2-enedioate;3-penta-1,4-dien-3-yloxypenta-1,4-diene |
|---|---|
| PubChem CID | 173320715 |
| Molecular Formula | C14H16CaO5 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | calcium;but-2-enedioate;3-penta-1,4-dien-3-yloxypenta-1,4-diene |
| SMILES | C=CC(C=C)OC(C=C)C=C.O=C([O-])C=CC(=O)[O-].[Ca+2] |
| InChI | InChI=1S/C10H14O.C4H4O4.Ca/c1-5-9(6-2)11-10(7-3)8-4;5-3(6)1-2-4(7)8;/h5-10H,1-4H2;1-2H,(H,5,6)(H,7,8);/q;;+2/p-2 |
| InChIKey | IIQCPRLRHNHBCZ-UHFFFAOYSA-L |
| XLogP | -0.85 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|