About 2-bromo-4-methoxy-6-[methyl(triphenyl)-λ5-phosphanyl]phenol
2-bromo-4-methoxy-6-[methyl(triphenyl)-λ5-phosphanyl]phenol (PubChem CID 173329205) has the molecular formula C26H24BrO2P
and a molecular weight of 479.35 g/mol. Its IUPAC name is 2-bromo-4-methoxy-6-[methyl(triphenyl)-λ5-phosphanyl]phenol.
Molecular Properties
| Compound Name | 2-bromo-4-methoxy-6-[methyl(triphenyl)-λ5-phosphanyl]phenol |
| PubChem CID | 173329205 |
| Molecular Formula | C26H24BrO2P |
| Molecular Weight | 479.35 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | 2-bromo-4-methoxy-6-[methyl(triphenyl)-λ5-phosphanyl]phenol |
| SMILES | COc1cc(Br)c(O)c(P(C)(c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C26H24BrO2P/c1-29-20-18-24(27)26(28)25(19-20)30(2,21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-19,28H,1-2H3 |
| InChIKey | MQBYAQFLWKJKSO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 479.35 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-methoxy-6-[methyl(triphenyl)-λ5-phosphanyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-methoxy-6-[methyl(triphenyl)-λ5-phosphanyl]phenol?
The IUPAC name of 2-bromo-4-methoxy-6-[methyl(triphenyl)-λ5-phosphanyl]phenol (CID 173329205) is 2-bromo-4-methoxy-6-[methyl(triphenyl)-λ5-phosphanyl]phenol.
What is the SMILES notation for 2-bromo-4-methoxy-6-[methyl(triphenyl)-λ5-phosphanyl]phenol?
The canonical SMILES for 2-bromo-4-methoxy-6-[methyl(triphenyl)-λ5-phosphanyl]phenol is COc1cc(Br)c(O)c(P(C)(c2ccccc2)(c2ccccc2)c2ccccc2)c1.
What is the InChIKey of 2-bromo-4-methoxy-6-[methyl(triphenyl)-λ5-phosphanyl]phenol?
The InChIKey is MQBYAQFLWKJKSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24BrO2P/c1-29-20-18-24(27)26(28)25(19-20)30(2,21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-19,28H,1-2H3.
What are the key properties of 2-bromo-4-methoxy-6-[methyl(triphenyl)-λ5-phosphanyl]phenol?
2-bromo-4-methoxy-6-[methyl(triphenyl)-λ5-phosphanyl]phenol has a molecular weight of 479.35 g/mol, XLogP of 4.95, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-methoxy-6-[methyl(triphenyl)-λ5-phosphanyl]phenol is sourced from PubChem (CID 173329205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).