C21H42O3Si — CID 173330564
1-[tert-butyl(dimethyl)silyl]-5-(3,7-dimethylocta-2,6-dienoxy)pentane-1,4-diol (PubChem CID 173330564) has the molecular formula C21H42O3Si and a molecular weight of 370.65 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]-5-(3,7-dimethylocta-2,6-dienoxy)pentane-1,4-diol.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]-5-(3,7-dimethylocta-2,6-dienoxy)pentane-1,4-diol |
|---|---|
| PubChem CID | 173330564 |
| Molecular Formula | C21H42O3Si |
| Molecular Weight | 370.65 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]-5-(3,7-dimethylocta-2,6-dienoxy)pentane-1,4-diol |
| SMILES | CC(C)=CCCC(C)=CCOCC(O)CCC(O)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O3Si/c1-17(2)10-9-11-18(3)14-15-24-16-19(22)12-13-20(23)25(7,8)21(4,5)6/h10,14,19-20,22-23H,9,11-13,15-16H2,1-8H3 |
| InChIKey | KPORCMNMQZPSGS-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.65 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|