C14H11F3N2OS — CID 173339098
(2Z)-2-cyano-3-hydroxy-N-[3-(trifluoromethyl)phenyl]hexa-2,5-dienethioamide (PubChem CID 173339098) has the molecular formula C14H11F3N2OS and a molecular weight of 312.32 g/mol. Its IUPAC name is (2Z)-2-cyano-3-hydroxy-N-[3-(trifluoromethyl)phenyl]hexa-2,5-dienethioamide.
| Compound Name | (2Z)-2-cyano-3-hydroxy-N-[3-(trifluoromethyl)phenyl]hexa-2,5-dienethioamide |
|---|---|
| PubChem CID | 173339098 |
| Molecular Formula | C14H11F3N2OS |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | (2Z)-2-cyano-3-hydroxy-N-[3-(trifluoromethyl)phenyl]hexa-2,5-dienethioamide |
| SMILES | C=CC/C(O)=C(\C#N)C(=S)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H11F3N2OS/c1-2-4-12(20)11(8-18)13(21)19-10-6-3-5-9(7-10)14(15,16)17/h2-3,5-7,20H,1,4H2,(H,19,21)/b12-11- |
| InChIKey | RITCGPZBJBQVMQ-QXMHVHEDSA-N |
| XLogP | 4.36 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|