About λ2-plumbane;octanedioic acid
λ2-plumbane;octanedioic acid (PubChem CID 173344232) has the molecular formula C8H16O4Pb
and a molecular weight of 383.41 g/mol. Its IUPAC name is λ2-plumbane;octanedioic acid.
Molecular Properties
| Compound Name | λ2-plumbane;octanedioic acid |
| PubChem CID | 173344232 |
| Molecular Formula | C8H16O4Pb |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | λ2-plumbane;octanedioic acid |
| SMILES | O=C(O)CCCCCCC(=O)O.[PbH2] |
| InChI | InChI=1S/C8H14O4.Pb.2H/c9-7(10)5-3-1-2-4-6-8(11)12;;;/h1-6H2,(H,9,10)(H,11,12);;; |
| InChIKey | MPSFDCQKBFGHMN-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze λ2-plumbane;octanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of λ2-plumbane;octanedioic acid?
The IUPAC name of λ2-plumbane;octanedioic acid (CID 173344232) is λ2-plumbane;octanedioic acid.
What is the SMILES notation for λ2-plumbane;octanedioic acid?
The canonical SMILES for λ2-plumbane;octanedioic acid is O=C(O)CCCCCCC(=O)O.[PbH2].
What is the InChIKey of λ2-plumbane;octanedioic acid?
The InChIKey is MPSFDCQKBFGHMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4.Pb.2H/c9-7(10)5-3-1-2-4-6-8(11)12;;;/h1-6H2,(H,9,10)(H,11,12);;;.
What are the key properties of λ2-plumbane;octanedioic acid?
λ2-plumbane;octanedioic acid has a molecular weight of 383.41 g/mol, XLogP of 0.58, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for λ2-plumbane;octanedioic acid is sourced from PubChem (CID 173344232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).