C15H24Cl2O5S2 — CID 173345453
2-butyl-2-(2,4-dichlorophenyl)oxirane;hydron;trimethylsulfanium;sulfate (PubChem CID 173345453) has the molecular formula C15H24Cl2O5S2 and a molecular weight of 419.39 g/mol. Its IUPAC name is 2-butyl-2-(2,4-dichlorophenyl)oxirane;hydron;trimethylsulfanium;sulfate.
| Compound Name | 2-butyl-2-(2,4-dichlorophenyl)oxirane;hydron;trimethylsulfanium;sulfate |
|---|---|
| PubChem CID | 173345453 |
| Molecular Formula | C15H24Cl2O5S2 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | 2-butyl-2-(2,4-dichlorophenyl)oxirane;hydron;trimethylsulfanium;sulfate |
| SMILES | CCCCC1(c2ccc(Cl)cc2Cl)CO1.C[S+](C)C.O=S(=O)([O-])[O-].[H+] |
| InChI | InChI=1S/C12H14Cl2O.C3H9S.H2O4S/c1-2-3-6-12(8-15-12)10-5-4-9(13)7-11(10)14;1-4(2)3;1-5(2,3)4/h4-5,7H,2-3,6,8H2,1H3;1-3H3;(H2,1,2,3,4)/q;+1;/p-1 |
| InChIKey | MGUIBRVRMUORDU-UHFFFAOYSA-M |
| XLogP | 3.68 |
| TPSA | 92.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|