C11H15NaO5S2 — CID 173350915
sodium;2-[1-(1,3-benzodioxol-5-yl)ethylsulfanyl]ethanesulfonic acid;hydride (PubChem CID 173350915) has the molecular formula C11H15NaO5S2 and a molecular weight of 314.36 g/mol. Its IUPAC name is sodium;2-[1-(1,3-benzodioxol-5-yl)ethylsulfanyl]ethanesulfonic acid;hydride.
| Compound Name | sodium;2-[1-(1,3-benzodioxol-5-yl)ethylsulfanyl]ethanesulfonic acid;hydride |
|---|---|
| PubChem CID | 173350915 |
| Molecular Formula | C11H15NaO5S2 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | sodium;2-[1-(1,3-benzodioxol-5-yl)ethylsulfanyl]ethanesulfonic acid;hydride |
| SMILES | CC(SCCS(=O)(=O)O)c1ccc2c(c1)OCO2.[H-].[Na+] |
| InChI | InChI=1S/C11H14O5S2.Na.H/c1-8(17-4-5-18(12,13)14)9-2-3-10-11(6-9)16-7-15-10;;/h2-3,6,8H,4-5,7H2,1H3,(H,12,13,14);;/q;+1;-1 |
| InChIKey | MZYHAYCIFQNCSP-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|