C24H52O4Si5 — CID 173352969
1-silylpropyl 2-methyl-4,4-bis(2,2,3,6,6-pentamethyloxadisilinan-3-yl)but-2-enoate (PubChem CID 173352969) has the molecular formula C24H52O4Si5 and a molecular weight of 545.11 g/mol. Its IUPAC name is 1-silylpropyl 2-methyl-4,4-bis(2,2,3,6,6-pentamethyloxadisilinan-3-yl)but-2-enoate.
| Compound Name | 1-silylpropyl 2-methyl-4,4-bis(2,2,3,6,6-pentamethyloxadisilinan-3-yl)but-2-enoate |
|---|---|
| PubChem CID | 173352969 |
| Molecular Formula | C24H52O4Si5 |
| Molecular Weight | 545.11 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | 1-silylpropyl 2-methyl-4,4-bis(2,2,3,6,6-pentamethyloxadisilinan-3-yl)but-2-enoate |
| SMILES | CCC([SiH3])OC(=O)C(C)=CC([Si]1(C)CCC(C)(C)O[Si]1(C)C)[Si]1(C)CCC(C)(C)O[Si]1(C)C |
| InChI | InChI=1S/C24H52O4Si5/c1-13-20(29)26-22(25)19(2)18-21(32(11)16-14-23(3,4)27-30(32,7)8)33(12)17-15-24(5,6)28-31(33,9)10/h18,20-21H,13-17H2,1-12,29H3 |
| InChIKey | IBCPNZSYIYMDJO-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.11 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|