C43H56Si — CID 173383969
2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl-tris(3,5-diethylphenyl)silane (PubChem CID 173383969) has the molecular formula C43H56Si and a molecular weight of 601.01 g/mol. Its IUPAC name is 2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl-tris(3,5-diethylphenyl)silane.
| Compound Name | 2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl-tris(3,5-diethylphenyl)silane |
|---|---|
| PubChem CID | 173383969 |
| Molecular Formula | C43H56Si |
| Molecular Weight | 601.01 g/mol |
| Exact Mass | 600.42 |
| IUPAC Name | 2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl-tris(3,5-diethylphenyl)silane |
| SMILES | CCc1cc(CC)cc([Si](c2cc(CC)cc(CC)c2)(c2cc(CC)cc(CC)c2)C2C3C=CC=CC3C3CCCCC32)c1 |
| InChI | InChI=1S/C43H56Si/c1-7-30-21-31(8-2)25-36(24-30)44(37-26-32(9-3)22-33(10-4)27-37,38-28-34(11-5)23-35(12-6)29-38)43-41-19-15-13-17-39(41)40-18-14-16-20-42(40)43/h13,15,17,19,21-29,39-43H,7-12,14,16,18,20H2,1-6H3 |
| InChIKey | INJSXEHSCHAQPG-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.01 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|