About sodium 3-methylbutanethioate
sodium 3-methylbutanethioate (PubChem CID 173401093) has the molecular formula C5H9NaOS
and a molecular weight of 140.18 g/mol. Its IUPAC name is sodium 3-methylbutanethioate.
Molecular Properties
| Compound Name | sodium 3-methylbutanethioate |
| PubChem CID | 173401093 |
| Molecular Formula | C5H9NaOS |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.03 |
| IUPAC Name | sodium 3-methylbutanethioate |
| SMILES | CC(C)CC([O-])=S.[Na+] |
| InChI | InChI=1S/C5H10OS.Na/c1-4(2)3-5(6)7;/h4H,3H2,1-2H3,(H,6,7);/q;+1/p-1 |
| InChIKey | HXNULBQEFKLSFI-UHFFFAOYSA-M |
| XLogP | -2.28 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze sodium 3-methylbutanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-methylbutanethioate?
The IUPAC name of sodium 3-methylbutanethioate (CID 173401093) is sodium 3-methylbutanethioate.
What is the SMILES notation for sodium 3-methylbutanethioate?
The canonical SMILES for sodium 3-methylbutanethioate is CC(C)CC([O-])=S.[Na+].
What is the InChIKey of sodium 3-methylbutanethioate?
The InChIKey is HXNULBQEFKLSFI-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H10OS.Na/c1-4(2)3-5(6)7;/h4H,3H2,1-2H3,(H,6,7);/q;+1/p-1.
What are the key properties of sodium 3-methylbutanethioate?
sodium 3-methylbutanethioate has a molecular weight of 140.18 g/mol, XLogP of -2.28, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-methylbutanethioate is sourced from PubChem (CID 173401093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).