C22H32Cl2O8 — CID 173416069
chloroethene;ethenyl acetate;2-methylprop-2-enoic acid;oxiran-2-ylmethyl 2-(oxiran-2-ylmethyl)but-3-enoate (PubChem CID 173416069) has the molecular formula C22H32Cl2O8 and a molecular weight of 495.40 g/mol. Its IUPAC name is chloroethene;ethenyl acetate;2-methylprop-2-enoic acid;oxiran-2-ylmethyl 2-(oxiran-2-ylmethyl)but-3-enoate.
| Compound Name | chloroethene;ethenyl acetate;2-methylprop-2-enoic acid;oxiran-2-ylmethyl 2-(oxiran-2-ylmethyl)but-3-enoate |
|---|---|
| PubChem CID | 173416069 |
| Molecular Formula | C22H32Cl2O8 |
| Molecular Weight | 495.40 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | chloroethene;ethenyl acetate;2-methylprop-2-enoic acid;oxiran-2-ylmethyl 2-(oxiran-2-ylmethyl)but-3-enoate |
| SMILES | C=C(C)C(=O)O.C=CC(CC1CO1)C(=O)OCC1CO1.C=CCl.C=CCl.C=COC(C)=O |
| InChI | InChI=1S/C10H14O4.2C4H6O2.2C2H3Cl/c1-2-7(3-8-4-12-8)10(11)14-6-9-5-13-9;1-3-6-4(2)5;1-3(2)4(5)6;2*1-2-3/h2,7-9H,1,3-6H2;3H,1H2,2H3;1H2,2H3,(H,5,6);2*2H,1H2 |
| InChIKey | FLIJWHJEALSSTN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 114.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|