C15H34O3SSi — CID 173419270
dimethyl-[methylsulfinyl(2,2,6,6-tetramethylheptan-4-yloxy)methoxy]silane (PubChem CID 173419270) has the molecular formula C15H34O3SSi and a molecular weight of 322.59 g/mol. Its IUPAC name is dimethyl-[methylsulfinyl(2,2,6,6-tetramethylheptan-4-yloxy)methoxy]silane.
| Compound Name | dimethyl-[methylsulfinyl(2,2,6,6-tetramethylheptan-4-yloxy)methoxy]silane |
|---|---|
| PubChem CID | 173419270 |
| Molecular Formula | C15H34O3SSi |
| Molecular Weight | 322.59 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | dimethyl-[methylsulfinyl(2,2,6,6-tetramethylheptan-4-yloxy)methoxy]silane |
| SMILES | C[SiH](C)OC(OC(CC(C)(C)C)CC(C)(C)C)S(C)=O |
| InChI | InChI=1S/C15H34O3SSi/c1-14(2,3)10-12(11-15(4,5)6)17-13(19(7)16)18-20(8)9/h12-13,20H,10-11H2,1-9H3 |
| InChIKey | INRKCIGBVNARCQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.59 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|