About 8-silyloctanoic acid
8-silyloctanoic acid (PubChem CID 173427081) has the molecular formula C8H18O2Si
and a molecular weight of 174.32 g/mol. Its IUPAC name is 8-silyloctanoic acid.
Molecular Properties
| Compound Name | 8-silyloctanoic acid |
| PubChem CID | 173427081 |
| Molecular Formula | C8H18O2Si |
| Molecular Weight | 174.32 g/mol |
| Exact Mass | 174.11 |
| IUPAC Name | 8-silyloctanoic acid |
| SMILES | O=C(O)CCCCCCC[SiH3] |
| InChI | InChI=1S/C8H18O2Si/c9-8(10)6-4-2-1-3-5-7-11/h1-7H2,11H3,(H,9,10) |
| InChIKey | YVIZCDQASWVIID-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 8-silyloctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-silyloctanoic acid?
The IUPAC name of 8-silyloctanoic acid (CID 173427081) is 8-silyloctanoic acid.
What is the SMILES notation for 8-silyloctanoic acid?
The canonical SMILES for 8-silyloctanoic acid is O=C(O)CCCCCCC[SiH3].
What is the InChIKey of 8-silyloctanoic acid?
The InChIKey is YVIZCDQASWVIID-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O2Si/c9-8(10)6-4-2-1-3-5-7-11/h1-7H2,11H3,(H,9,10).
What are the key properties of 8-silyloctanoic acid?
8-silyloctanoic acid has a molecular weight of 174.32 g/mol, XLogP of 1.20, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-silyloctanoic acid is sourced from PubChem (CID 173427081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).