C17H23NO7 — CID 173432295
2-(carboxymethyl)-2,4-dihydroxy-4-oxobutanoate;3-methyl-1-(3-methylbut-2-enyl)pyridin-1-ium (PubChem CID 173432295) has the molecular formula C17H23NO7 and a molecular weight of 353.37 g/mol. Its IUPAC name is 2-(carboxymethyl)-2,4-dihydroxy-4-oxobutanoate;3-methyl-1-(3-methylbut-2-enyl)pyridin-1-ium.
| Compound Name | 2-(carboxymethyl)-2,4-dihydroxy-4-oxobutanoate;3-methyl-1-(3-methylbut-2-enyl)pyridin-1-ium |
|---|---|
| PubChem CID | 173432295 |
| Molecular Formula | C17H23NO7 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 2-(carboxymethyl)-2,4-dihydroxy-4-oxobutanoate;3-methyl-1-(3-methylbut-2-enyl)pyridin-1-ium |
| SMILES | CC(C)=CC[n+]1cccc(C)c1.O=C(O)CC(O)(CC(=O)O)C(=O)[O-] |
| InChI | InChI=1S/C11H16N.C6H8O7/c1-10(2)6-8-12-7-4-5-11(3)9-12;7-3(8)1-6(13,5(11)12)2-4(9)10/h4-7,9H,8H2,1-3H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/q+1;/p-1 |
| InChIKey | QPAZCEZVUUUWOO-UHFFFAOYSA-M |
| XLogP | -0.33 |
| TPSA | 138.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|