C6H6NNaO4S2 — CID 173445761
sodium 2-amino-2-oxo-1-thiophen-2-ylethanesulfonate (PubChem CID 173445761) has the molecular formula C6H6NNaO4S2 and a molecular weight of 243.24 g/mol. Its IUPAC name is sodium 2-amino-2-oxo-1-thiophen-2-ylethanesulfonate.
| Compound Name | sodium 2-amino-2-oxo-1-thiophen-2-ylethanesulfonate |
|---|---|
| PubChem CID | 173445761 |
| Molecular Formula | C6H6NNaO4S2 |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 242.96 |
| IUPAC Name | sodium 2-amino-2-oxo-1-thiophen-2-ylethanesulfonate |
| SMILES | NC(=O)C(c1cccs1)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C6H7NO4S2.Na/c7-6(8)5(13(9,10)11)4-2-1-3-12-4;/h1-3,5H,(H2,7,8)(H,9,10,11);/q;+1/p-1 |
| InChIKey | FJFQEVXKJJRFNX-UHFFFAOYSA-M |
| XLogP | -3.18 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|