C17H23F3N4O3S — CID 173453272
methyl N-butyl-N'-(dimethylcarbamoyl)-N-[[4-(trifluoromethyl)phenyl]sulfanylcarbamoyl]carbamimidate (PubChem CID 173453272) has the molecular formula C17H23F3N4O3S and a molecular weight of 420.46 g/mol. Its IUPAC name is methyl N-butyl-N'-(dimethylcarbamoyl)-N-[[4-(trifluoromethyl)phenyl]sulfanylcarbamoyl]carbamimidate.
| Compound Name | methyl N-butyl-N'-(dimethylcarbamoyl)-N-[[4-(trifluoromethyl)phenyl]sulfanylcarbamoyl]carbamimidate |
|---|---|
| PubChem CID | 173453272 |
| Molecular Formula | C17H23F3N4O3S |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | methyl N-butyl-N'-(dimethylcarbamoyl)-N-[[4-(trifluoromethyl)phenyl]sulfanylcarbamoyl]carbamimidate |
| SMILES | CCCCN(C(=O)NSc1ccc(C(F)(F)F)cc1)C(=NC(=O)N(C)C)OC |
| InChI | InChI=1S/C17H23F3N4O3S/c1-5-6-11-24(16(27-4)21-14(25)23(2)3)15(26)22-28-13-9-7-12(8-10-13)17(18,19)20/h7-10H,5-6,11H2,1-4H3,(H,22,26) |
| InChIKey | FCNZPZDJOMPMTK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|