About N'-[(E)-1,2-diamino-2-chloroethenyl]-2-(imidazole-1-carbonyl)prop-2-enimidamide
N'-[(E)-1,2-diamino-2-chloroethenyl]-2-(imidazole-1-carbonyl)prop-2-enimidamide (PubChem CID 173471345) has the molecular formula C9H11ClN6O
and a molecular weight of 254.68 g/mol. Its IUPAC name is N'-[(E)-1,2-diamino-2-chloroethenyl]-2-(imidazole-1-carbonyl)prop-2-enimidamide.
Molecular Properties
| Compound Name | N'-[(E)-1,2-diamino-2-chloroethenyl]-2-(imidazole-1-carbonyl)prop-2-enimidamide |
| PubChem CID | 173471345 |
| Molecular Formula | C9H11ClN6O |
| Molecular Weight | 254.68 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | N'-[(E)-1,2-diamino-2-chloroethenyl]-2-(imidazole-1-carbonyl)prop-2-enimidamide |
| SMILES | C=C(C(=O)n1ccnc1)C(N)=N/C(N)=C(\N)Cl |
| InChI | InChI=1S/C9H11ClN6O/c1-5(7(12)15-8(13)6(10)11)9(17)16-3-2-14-4-16/h2-4H,1,11,13H2,(H2,12,15)/b8-6- |
| InChIKey | VGOFDLHHQBILTB-VURMDHGXSA-N |
| XLogP | -0.28 |
| TPSA | 125.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.68 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N'-[(E)-1,2-diamino-2-chloroethenyl]-2-(imidazole-1-carbonyl)prop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(E)-1,2-diamino-2-chloroethenyl]-2-(imidazole-1-carbonyl)prop-2-enimidamide?
The IUPAC name of N'-[(E)-1,2-diamino-2-chloroethenyl]-2-(imidazole-1-carbonyl)prop-2-enimidamide (CID 173471345) is N'-[(E)-1,2-diamino-2-chloroethenyl]-2-(imidazole-1-carbonyl)prop-2-enimidamide.
What is the SMILES notation for N'-[(E)-1,2-diamino-2-chloroethenyl]-2-(imidazole-1-carbonyl)prop-2-enimidamide?
The canonical SMILES for N'-[(E)-1,2-diamino-2-chloroethenyl]-2-(imidazole-1-carbonyl)prop-2-enimidamide is C=C(C(=O)n1ccnc1)C(N)=N/C(N)=C(\N)Cl.
What is the InChIKey of N'-[(E)-1,2-diamino-2-chloroethenyl]-2-(imidazole-1-carbonyl)prop-2-enimidamide?
The InChIKey is VGOFDLHHQBILTB-VURMDHGXSA-N. The full InChI is InChI=1S/C9H11ClN6O/c1-5(7(12)15-8(13)6(10)11)9(17)16-3-2-14-4-16/h2-4H,1,11,13H2,(H2,12,15)/b8-6-.
What are the key properties of N'-[(E)-1,2-diamino-2-chloroethenyl]-2-(imidazole-1-carbonyl)prop-2-enimidamide?
N'-[(E)-1,2-diamino-2-chloroethenyl]-2-(imidazole-1-carbonyl)prop-2-enimidamide has a molecular weight of 254.68 g/mol, XLogP of -0.28, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(E)-1,2-diamino-2-chloroethenyl]-2-(imidazole-1-carbonyl)prop-2-enimidamide is sourced from PubChem (CID 173471345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).