C15H22BN3O4S — CID 173497864
CID 173497864 (PubChem CID 173497864) has the molecular formula C15H22BN3O4S and a molecular weight of 351.24 g/mol.
| Compound Name | CID 173497864 |
|---|---|
| PubChem CID | 173497864 |
| Molecular Formula | C15H22BN3O4S |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | — |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)N(C)C(=O)OCC(C)c1cc([B])cs1 |
| InChI | InChI=1S/C15H22BN3O4S/c1-9(11-6-10(16)8-24-11)7-22-14(21)19(5)12(17)18-13(20)23-15(2,3)4/h6,8-9H,7H2,1-5H3,(H2,17,18,20) |
| InChIKey | GVMOXGVKGZSGDQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|