C24H23ClFN3O3S3 — CID 17373217
ethyl 5-benzyl-2-[[[2-[(2-chloro-4-fluorophenyl)methylsulfanyl]acetyl]amino]carbamothioylamino]thiophene-3-carboxylate (PubChem CID 17373217) has the molecular formula C24H23ClFN3O3S3 and a molecular weight of 552.12 g/mol. Its IUPAC name is ethyl 5-benzyl-2-[[[2-[(2-chloro-4-fluorophenyl)methylsulfanyl]acetyl]amino]carbamothioylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-benzyl-2-[[[2-[(2-chloro-4-fluorophenyl)methylsulfanyl]acetyl]amino]carbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17373217 |
| Molecular Formula | C24H23ClFN3O3S3 |
| Molecular Weight | 552.12 g/mol |
| Exact Mass | 551.06 |
| IUPAC Name | ethyl 5-benzyl-2-[[[2-[(2-chloro-4-fluorophenyl)methylsulfanyl]acetyl]amino]carbamothioylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(Cc2ccccc2)sc1NC(=S)NNC(=O)CSCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C24H23ClFN3O3S3/c1-2-32-23(31)19-12-18(10-15-6-4-3-5-7-15)35-22(19)27-24(33)29-28-21(30)14-34-13-16-8-9-17(26)11-20(16)25/h3-9,11-12H,2,10,13-14H2,1H3,(H,28,30)(H2,27,29,33) |
| InChIKey | DYSHIXLAMNHXDQ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.12 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|