C22H25N5O4S2 — CID 17375684
methyl 2-[[1-ethyl-3-(2-methoxyethylcarbamoyl)pyrazol-4-yl]carbamothioylamino]-5-phenylthiophene-3-carboxylate (PubChem CID 17375684) has the molecular formula C22H25N5O4S2 and a molecular weight of 487.61 g/mol. Its IUPAC name is methyl 2-[[1-ethyl-3-(2-methoxyethylcarbamoyl)pyrazol-4-yl]carbamothioylamino]-5-phenylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[1-ethyl-3-(2-methoxyethylcarbamoyl)pyrazol-4-yl]carbamothioylamino]-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 17375684 |
| Molecular Formula | C22H25N5O4S2 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | methyl 2-[[1-ethyl-3-(2-methoxyethylcarbamoyl)pyrazol-4-yl]carbamothioylamino]-5-phenylthiophene-3-carboxylate |
| SMILES | CCn1cc(NC(=S)Nc2sc(-c3ccccc3)cc2C(=O)OC)c(C(=O)NCCOC)n1 |
| InChI | InChI=1S/C22H25N5O4S2/c1-4-27-13-16(18(26-27)19(28)23-10-11-30-2)24-22(32)25-20-15(21(29)31-3)12-17(33-20)14-8-6-5-7-9-14/h5-9,12-13H,4,10-11H2,1-3H3,(H,23,28)(H2,24,25,32) |
| InChIKey | LOLJHQLALMEKAK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|