C19H17Cl2N3O3S2 — CID 17379235
4-(2,4-dichlorophenoxy)-N-(12-oxo-10-sulfanylidene-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6)-dien-11-yl)butanamide (PubChem CID 17379235) has the molecular formula C19H17Cl2N3O3S2 and a molecular weight of 470.40 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-(12-oxo-10-sulfanylidene-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6)-dien-11-yl)butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-(12-oxo-10-sulfanylidene-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6)-dien-11-yl)butanamide |
|---|---|
| PubChem CID | 17379235 |
| Molecular Formula | C19H17Cl2N3O3S2 |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 469.01 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-(12-oxo-10-sulfanylidene-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6)-dien-11-yl)butanamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)Nn1c(=S)[nH]c2sc3c(c2c1=O)CCC3 |
| InChI | InChI=1S/C19H17Cl2N3O3S2/c20-10-6-7-13(12(21)9-10)27-8-2-5-15(25)23-24-18(26)16-11-3-1-4-14(11)29-17(16)22-19(24)28/h6-7,9H,1-5,8H2,(H,22,28)(H,23,25) |
| InChIKey | YBLLHGKNTKWLOG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|