C36H51N2O5+ — CID 174019472
5-[1-[2-(1,3-dioxolan-2-yl)ethyl]-2-[4-hydroxy-3-methyl-4-(9-methyl-3,4,6,7,8,9-hexahydro-2H-quinolizin-5-ium-1-ylidene)but-2-enylidene]-3-methylindol-3-yl]pentyl acetate (PubChem CID 174019472) has the molecular formula C36H51N2O5+ and a molecular weight of 591.81 g/mol. Its IUPAC name is 5-[1-[2-(1,3-dioxolan-2-yl)ethyl]-2-[4-hydroxy-3-methyl-4-(9-methyl-3,4,6,7,8,9-hexahydro-2H-quinolizin-5-ium-1-ylidene)but-2-enylidene]-3-methylindol-3-yl]pentyl acetate.
| Compound Name | 5-[1-[2-(1,3-dioxolan-2-yl)ethyl]-2-[4-hydroxy-3-methyl-4-(9-methyl-3,4,6,7,8,9-hexahydro-2H-quinolizin-5-ium-1-ylidene)but-2-enylidene]-3-methylindol-3-yl]pentyl acetate |
|---|---|
| PubChem CID | 174019472 |
| Molecular Formula | C36H51N2O5+ |
| Molecular Weight | 591.81 g/mol |
| Exact Mass | 591.38 |
| IUPAC Name | 5-[1-[2-(1,3-dioxolan-2-yl)ethyl]-2-[4-hydroxy-3-methyl-4-(9-methyl-3,4,6,7,8,9-hexahydro-2H-quinolizin-5-ium-1-ylidene)but-2-enylidene]-3-methylindol-3-yl]pentyl acetate |
| SMILES | CC(=O)OCCCCCC1(C)C(=CC=C(C)C(O)=C2CCC[N+]3=C2C(C)CCC3)N(CCC2OCCO2)c2ccccc21 |
| InChI | InChI=1S/C36H50N2O5/c1-26-12-10-20-37-21-11-13-29(34(26)37)35(40)27(2)16-17-32-36(4,19-8-5-9-23-41-28(3)39)30-14-6-7-15-31(30)38(32)22-18-33-42-24-25-43-33/h6-7,14-17,26,33H,5,8-13,18-25H2,1-4H3/p+1 |
| InChIKey | ARHJMLOGCSCJOB-UHFFFAOYSA-O |
| XLogP | 6.97 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.81 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|