C14H16Br2O2 — CID 174042600
2,10-dibromotetracyclo[9.2.1.05,13.07,12]tetradecane-6,14-dione (PubChem CID 174042600) has the molecular formula C14H16Br2O2 and a molecular weight of 376.09 g/mol. Its IUPAC name is 2,10-dibromotetracyclo[9.2.1.05,13.07,12]tetradecane-6,14-dione.
| Compound Name | 2,10-dibromotetracyclo[9.2.1.05,13.07,12]tetradecane-6,14-dione |
|---|---|
| PubChem CID | 174042600 |
| Molecular Formula | C14H16Br2O2 |
| Molecular Weight | 376.09 g/mol |
| Exact Mass | 373.95 |
| IUPAC Name | 2,10-dibromotetracyclo[9.2.1.05,13.07,12]tetradecane-6,14-dione |
| SMILES | O=C1C2CCC(Br)C3C(=O)C4C(Br)CCC1C4C23 |
| InChI | InChI=1S/C14H16Br2O2/c15-7-3-1-5-9-10-6(13(5)17)2-4-8(16)12(10)14(18)11(7)9/h5-12H,1-4H2 |
| InChIKey | DBSGWHIYVVPDAG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.09 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|