C15H22Br2N2O — CID 57351642
4,6-dibromo-1,2,3,3a,4,5,6,6a,7a,8,9,10,11,11a,11b,11c-hexadecahydrobenzo[e]perimidin-7-one (PubChem CID 57351642) has the molecular formula C15H22Br2N2O and a molecular weight of 406.16 g/mol. Its IUPAC name is 4,6-dibromo-1,2,3,3a,4,5,6,6a,7a,8,9,10,11,11a,11b,11c-hexadecahydrobenzo[e]perimidin-7-one.
| Compound Name | 4,6-dibromo-1,2,3,3a,4,5,6,6a,7a,8,9,10,11,11a,11b,11c-hexadecahydrobenzo[e]perimidin-7-one |
|---|---|
| PubChem CID | 57351642 |
| Molecular Formula | C15H22Br2N2O |
| Molecular Weight | 406.16 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | 4,6-dibromo-1,2,3,3a,4,5,6,6a,7a,8,9,10,11,11a,11b,11c-hexadecahydrobenzo[e]perimidin-7-one |
| SMILES | O=C1C2CCCCC2C2NCNC3C(Br)CC(Br)C1C32 |
| InChI | InChI=1S/C15H22Br2N2O/c16-9-5-10(17)14-12-11(9)15(20)8-4-2-1-3-7(8)13(12)18-6-19-14/h7-14,18-19H,1-6H2 |
| InChIKey | LTFRBIXFBSFGGA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.16 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|