C16H28BNO2 — CID 174044217
(E)-3,3,5-trimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-6-enenitrile (PubChem CID 174044217) has the molecular formula C16H28BNO2 and a molecular weight of 277.22 g/mol. Its IUPAC name is (E)-3,3,5-trimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-6-enenitrile.
| Compound Name | (E)-3,3,5-trimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-6-enenitrile |
|---|---|
| PubChem CID | 174044217 |
| Molecular Formula | C16H28BNO2 |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | (E)-3,3,5-trimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-6-enenitrile |
| SMILES | CC(/C=C/B1OC(C)(C)C(C)(C)O1)CC(C)(C)CC#N |
| InChI | InChI=1S/C16H28BNO2/c1-13(12-14(2,3)9-11-18)8-10-17-19-15(4,5)16(6,7)20-17/h8,10,13H,9,12H2,1-7H3/b10-8+ |
| InChIKey | TXSCPAKMFMCDNY-CSKARUKUSA-N |
| XLogP | 4.14 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|