C18H22BClN2O4 — CID 174049296
5-chloropyridin-2-amine;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (PubChem CID 174049296) has the molecular formula C18H22BClN2O4 and a molecular weight of 376.65 g/mol. Its IUPAC name is 5-chloropyridin-2-amine;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid.
| Compound Name | 5-chloropyridin-2-amine;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 174049296 |
| Molecular Formula | C18H22BClN2O4 |
| Molecular Weight | 376.65 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 5-chloropyridin-2-amine;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| SMILES | CC1(C)OB(c2ccc(C(=O)O)cc2)OC1(C)C.Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C13H17BO4.C5H5ClN2/c1-12(2)13(3,4)18-14(17-12)10-7-5-9(6-8-10)11(15)16;6-4-1-2-5(7)8-3-4/h5-8H,1-4H3,(H,15,16);1-3H,(H2,7,8) |
| InChIKey | AQVYYHBGXVZLJF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 94.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.65 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|