C19H29BN2O3 — CID 148593036
1-[[3-amino-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enylidene]amino]-2-methylpropan-2-ol (PubChem CID 148593036) has the molecular formula C19H29BN2O3 and a molecular weight of 344.26 g/mol. Its IUPAC name is 1-[[3-amino-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enylidene]amino]-2-methylpropan-2-ol.
| Compound Name | 1-[[3-amino-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enylidene]amino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 148593036 |
| Molecular Formula | C19H29BN2O3 |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | 1-[[3-amino-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enylidene]amino]-2-methylpropan-2-ol |
| SMILES | CC(C)(O)C/N=C/C(=CN)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C19H29BN2O3/c1-17(2,23)13-22-12-15(11-21)14-7-9-16(10-8-14)20-24-18(3,4)19(5,6)25-20/h7-12,23H,13,21H2,1-6H3/b15-11?,22-12+ |
| InChIKey | BTYQLTGDALPVNP-FQMBPZNMSA-N |
| XLogP | 2.13 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|