About S-(2-aminoethyl) 2-amino-3-(2-aminoethyldisulfanyl)propanethioate;trihydrochloride
S-(2-aminoethyl) 2-amino-3-(2-aminoethyldisulfanyl)propanethioate;trihydrochloride (PubChem CID 174053552) has the molecular formula C7H20Cl3N3OS3
and a molecular weight of 364.82 g/mol. Its IUPAC name is S-(2-aminoethyl) 2-amino-3-(2-aminoethyldisulfanyl)propanethioate;trihydrochloride.
Molecular Properties
| Compound Name | S-(2-aminoethyl) 2-amino-3-(2-aminoethyldisulfanyl)propanethioate;trihydrochloride |
| PubChem CID | 174053552 |
| Molecular Formula | C7H20Cl3N3OS3 |
| Molecular Weight | 364.82 g/mol |
| Exact Mass | 362.98 |
| IUPAC Name | S-(2-aminoethyl) 2-amino-3-(2-aminoethyldisulfanyl)propanethioate;trihydrochloride |
| SMILES | Cl.Cl.Cl.NCCSSCC(N)C(=O)SCCN |
| InChI | InChI=1S/C7H17N3OS3.3ClH/c8-1-3-12-7(11)6(10)5-14-13-4-2-9;;;/h6H,1-5,8-10H2;3*1H |
| InChIKey | BPOKDEFEGNWWPA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.82 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-aminoethyl) 2-amino-3-(2-aminoethyldisulfanyl)propanethioate;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-aminoethyl) 2-amino-3-(2-aminoethyldisulfanyl)propanethioate;trihydrochloride?
The IUPAC name of S-(2-aminoethyl) 2-amino-3-(2-aminoethyldisulfanyl)propanethioate;trihydrochloride (CID 174053552) is S-(2-aminoethyl) 2-amino-3-(2-aminoethyldisulfanyl)propanethioate;trihydrochloride.
What is the SMILES notation for S-(2-aminoethyl) 2-amino-3-(2-aminoethyldisulfanyl)propanethioate;trihydrochloride?
The canonical SMILES for S-(2-aminoethyl) 2-amino-3-(2-aminoethyldisulfanyl)propanethioate;trihydrochloride is Cl.Cl.Cl.NCCSSCC(N)C(=O)SCCN.
What is the InChIKey of S-(2-aminoethyl) 2-amino-3-(2-aminoethyldisulfanyl)propanethioate;trihydrochloride?
The InChIKey is BPOKDEFEGNWWPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N3OS3.3ClH/c8-1-3-12-7(11)6(10)5-14-13-4-2-9;;;/h6H,1-5,8-10H2;3*1H.
What are the key properties of S-(2-aminoethyl) 2-amino-3-(2-aminoethyldisulfanyl)propanethioate;trihydrochloride?
S-(2-aminoethyl) 2-amino-3-(2-aminoethyldisulfanyl)propanethioate;trihydrochloride has a molecular weight of 364.82 g/mol, XLogP of 1.14, 8 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-aminoethyl) 2-amino-3-(2-aminoethyldisulfanyl)propanethioate;trihydrochloride is sourced from PubChem (CID 174053552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).